5-Bromonicotinoyl chloride manufacturers
|
| | 5-Bromonicotinoyl chloride Basic information |
| | 5-Bromonicotinoyl chloride Chemical Properties |
| Melting point | 72-74°C | | Boiling point | 265.4±25.0 °C(Predicted) | | density | 1.760±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.27±0.20(Predicted) | | form | crystalline powder | | color | White | | Sensitive | Moisture Sensitive | | BRN | 115810 | | InChI | InChI=1S/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H | | InChIKey | FMDREJRIXNEGEG-UHFFFAOYSA-N | | SMILES | C(Cl)(C1=CC(Br)=CN=C1)=O | | CAS DataBase Reference | 39620-02-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2933399990 |
| Provider | Language |
|
ALFA
| English |
| | 5-Bromonicotinoyl chloride Usage And Synthesis |
| Uses | 5-Bromonicotinoyl Chloride is a building block that has been used as a reactant for the preparation of fosmidomycin analogs as an antimalarial compound with DXR inhibition activity and the preparation of cupsin 1, an upregulator of survival motor neuron (SMN) protein-1. | | Application | 5-Bromonicotinoyl chloride can serve as a key intermediate in pharmaceutical synthesis and is widely used in the preparation of pyridine-ring-containing active drug molecules such as antimalarial drugs and SMN protein upregulators. |
| | 5-Bromonicotinoyl chloride Preparation Products And Raw materials |
|