|
|
| | 5-Bromo-4,6-dihydroxypyrimidine Basic information |
| | 5-Bromo-4,6-dihydroxypyrimidine Chemical Properties |
| Melting point | 263-264 °C (decomp)(Solv: water (7732-18-5)) | | density | 2.25±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.09±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H3BrN2O2/c5-2-3(8)6-1-7-4(2)9/h1H,(H2,6,7,8,9) | | InChIKey | XVXHFPZMRQXGBM-UHFFFAOYSA-N | | SMILES | C1=NC(O)=C(Br)C(=O)N1 | | CAS DataBase Reference | 15726-38-2(CAS DataBase Reference) |
| | 5-Bromo-4,6-dihydroxypyrimidine Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder | | Uses | 5-Bromo-4,6-dihydroxypyrimidine is mainly used as a pharmaceutical intermediate, especially in the synthesis of certain drug molecules. |
| | 5-Bromo-4,6-dihydroxypyrimidine Preparation Products And Raw materials |
|