|
|
| | Methyltris(dimethylsiloxy)silane Basic information |
| Product Name: | Methyltris(dimethylsiloxy)silane | | Synonyms: | 3-dimethylsilanyloxy-1,1,3,5,5-pentamethyl-trisiloxane;Methyltris(dimethylhydrogensiloxy)silane;3-[(dimethylsilyl)oxy]-1,1,3,5,5-pentamethyltrisiloxane;Tris(dimethylsiloxy)methyl-silane;tris(dimethylsilyloxy)methylsilane;METHYLTRIS(DIMETHYLSILOXY)SILANE;Methyl-tris(dimethylsiloxy)silane, Tris(dimethylsiloxy)(methyl)silane;Methyl-tri(Dimethylsiloxy)silane | | CAS: | 17082-46-1 | | MF: | C7H24O3Si4 | | MW: | 268.61 | | EINECS: | 241-136-2 | | Product Categories: | | | Mol File: | 17082-46-1.mol |  |
| | Methyltris(dimethylsiloxy)silane Chemical Properties |
| Melting point | -155°C | | Boiling point | 68 °C5 mm Hg(lit.) | | density | 0.861 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.384(lit.) | | Fp | 103 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.861 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | InChI | InChI=1S/C7H24O3Si4/c1-11(2)8-14(7,9-12(3)4)10-13(5)6/h11-13H,1-7H3 | | InChIKey | DYXYFYSDMOOWRX-UHFFFAOYSA-N | | SMILES | [SiH](C)(C)O[Si](O[SiH](C)C)(C)O[SiH](C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HS Code | 2931.90.9010 |
| | Methyltris(dimethylsiloxy)silane Usage And Synthesis |
| Uses |
Methyltris(dimethylsiloxy)silane is a liquid, can be used as a chemical intermediate.
|
| | Methyltris(dimethylsiloxy)silane Preparation Products And Raw materials |
|