|
|
| | 3,5-DIIODO-4-HYDROXYBENZALDEHYDE Basic information |
| | 3,5-DIIODO-4-HYDROXYBENZALDEHYDE Chemical Properties |
| Melting point | 202-203°C | | Boiling point | 284.1±40.0 °C(Predicted) | | density | 2.602±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly) | | form | Solid | | pka | 4.89±0.23(Predicted) | | color | White to Pale Yellow | | Water Solubility | Insoluble in water. Sparingly soluble in chloroform and methanol. | | Sensitive | Air & Light Sensitive | | BRN | 1283414 | | InChI | InChI=1S/C7H4I2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H | | InChIKey | WHLUEIMENHLCMY-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(I)=C(O)C(I)=C1 | | CAS DataBase Reference | 1948-40-9(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2913000090 |
| Provider | Language |
|
ALFA
| English |
| | 3,5-DIIODO-4-HYDROXYBENZALDEHYDE Usage And Synthesis |
| Chemical Properties | Pale Beige Solid | | Uses | 3,5-Diiodo-4-hydroxybenzaldehyde (cas# 1948-40-9) is a compound useful in organic synthesis. |
| | 3,5-DIIODO-4-HYDROXYBENZALDEHYDE Preparation Products And Raw materials |
|