|
|
| | 5-METHYL-4-HEXENOIC ACID Basic information |
| | 5-METHYL-4-HEXENOIC ACID Chemical Properties |
| Melting point | -28°C | | Boiling point | 237.28°C (estimate) | | density | 0.9862 | | refractive index | 1.4504 | | pka | pK1:4.8 (25°C) | | InChI | InChI=1S/C7H12O2/c1-6(2)4-3-5-7(8)9/h4H,3,5H2,1-2H3,(H,8,9) | | InChIKey | YJJLHGCCADOOPZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC/C=C(\C)/C |
| | 5-METHYL-4-HEXENOIC ACID Usage And Synthesis |
| Uses | 5-Methylhex-4-enoic acid is used as a reactant in the preparation of 5-fluoromethyl-substituted γ-lactams. |
| | 5-METHYL-4-HEXENOIC ACID Preparation Products And Raw materials |
|