| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Z-Gly-Pro-OH
-
- $2.00
-
2026-08-25
- CAS:1160-54-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Z-GLY-PRO-OH
-
-
2025-12-24
- CAS:1160-54-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
|
| | Z-GLY-PRO-OH Basic information |
| Product Name: | Z-GLY-PRO-OH | | Synonyms: | Z-GLY-PRO-OH;Z-GLYCYL-L-PROLINE;Z-L-GLYCYL-L-PROLINE;N-BENZYLOXYCARBONYLGLYCYL-L-PROLINE;N-CARBOBENZOXYGLYCYL-L-PROLINE;BENZYLOXYCARBONYLGLYCYL-L-PROLINE;1-[N-[(phenylmethoxy)carbonyl]glycyl]-L-proline;N-carbobenzoxyglycylproline | | CAS: | 1160-54-9 | | MF: | C15H18N2O5 | | MW: | 306.31 | | EINECS: | 214-598-8 | | Product Categories: | | | Mol File: | 1160-54-9.mol |  |
| | Z-GLY-PRO-OH Chemical Properties |
| Melting point | 155-158 °C | | Boiling point | 579.8±50.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.51±0.20(Predicted) | | form | powder | | Optical Rotation | [α]20/D 70±2°, c = 2% in ethanol | | BRN | 94536 | | Major Application | peptide synthesis | | InChI | 1S/C15H18N2O5/c18-13(17-8-4-7-12(17)14(19)20)9-16-15(21)22-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,16,21)(H,19,20)/t12-/m0/s1 | | InChIKey | ZTUKZKYDJMGJDC-LBPRGKRZSA-N | | SMILES | OC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OCc2ccccc2 | | CAS DataBase Reference | 1160-54-9(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-GLY-PRO-OH Usage And Synthesis |
| Uses | peptide synthesis | | Definition | ChEBI: Z-Gly-Pro is a peptide. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-GLY-PRO-OH Preparation Products And Raw materials |
|