| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Diisodecyl phenyl phosphite Basic information |
| | Diisodecyl phenyl phosphite Chemical Properties |
| Boiling point | 176 °C5 mm Hg(lit.) | | density | 0.94 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.48(lit.) | | Fp | >230 °F | | Henry's Law Constant | 1.9×100 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C26H47O3P/c1-24(2)18-12-7-5-9-16-22-27-30(29-26-20-14-11-15-21-26)28-23-17-10-6-8-13-19-25(3)4/h11,14-15,20-21,24-25H,5-10,12-13,16-19,22-23H2,1-4H3 | | InChIKey | SXXILWLQSQDLDL-UHFFFAOYSA-N | | SMILES | P(OCCCCCCCC(C)C)(OCCCCCCCC(C)C)OC1C=CC=CC=1 | | EPA Substance Registry System | Diisodecyl phenyl phosphite (25550-98-5) |
| Safety Statements | 23-24/25 | | WGK Germany | 2 | | TSCA | TSCA listed |
| | Diisodecyl phenyl phosphite Usage And Synthesis |
| Uses | DIISODECYL PHENYL PHOSPHITE is used as polymer heat stabilizers. |
| | Diisodecyl phenyl phosphite Preparation Products And Raw materials |
|