| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Triisodecyl Phosphite
-
- $2.20
-
2026-08-25
- CAS:25448-25-3
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 1000kg
- JADEWIN AN 1610
-
-
2026-06-02
- CAS:25448-25-3
- Min. Order: 180KG
- Purity: 0
- Supply Ability: 1000
|
| | Phosphorous acid triisodecyl ester Basic information |
| | Phosphorous acid triisodecyl ester Chemical Properties |
| Boiling point | 166 °C(lit.) | | density | 0.884 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.46(lit.) | | Fp | >230 °F | | solubility | very soluble in Ethanol,Toluene | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | 0.02ng/L at 25℃ | | InChI | InChI=1S/C30H63O3P/c1-28(2)22-16-10-7-13-19-25-31-34(32-26-20-14-8-11-17-23-29(3)4)33-27-21-15-9-12-18-24-30(5)6/h28-30H,7-27H2,1-6H3 | | InChIKey | QEDNBHNWMHJNAB-UHFFFAOYSA-N | | SMILES | P(OCCCCCCCC(C)C)(OCCCCCCCC(C)C)OCCCCCCCC(C)C | | LogP | 12.31 at 25℃ | | EPA Substance Registry System | Phosphorous acid, triisodecyl ester (25448-25-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | TH1140000 | | TSCA | TSCA listed | | HS Code | 2920.90.5100 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Sens. 1 |
| | Phosphorous acid triisodecyl ester Usage And Synthesis |
| Uses | Heat stabilizer for polymers | | Hazard | Low toxicity by ingestion, inhalation, and
skin contact. A skin irritant. |
| | Phosphorous acid triisodecyl ester Preparation Products And Raw materials |
|