Nifedipine Impurity 9 manufacturers
|
| | Nifedipine Impurity 9 Basic information |
| Product Name: | Nifedipine Impurity 9 | | Synonyms: | Nifedipine Impurity 9;Nicardipine Cyclohexenone Impurity;methyl 3-methyl-3'-nitro-5-oxo-1,2,5,6-tetrahydro-[1,1'-biphenyl]-2-carboxylate;Nicardipine Impurity85;Methyl 2-methyl-6-(3-nitrophenyl)4-oxocyclohex-2-ene-1-carboxylate;Nifedipine Impurity 33;Nifedipine Impurity 9(Nicardipine Impurity A);2-Cyclohexene-1-carboxylic acid, 2-methyl-6-(3-nitrophenyl)-4-oxo-, methyl ester | | CAS: | 87625-92-1 | | MF: | C15H15NO5 | | MW: | 289.28 | | EINECS: | | | Product Categories: | | | Mol File: | 87625-92-1.mol |  |
| | Nifedipine Impurity 9 Chemical Properties |
| Boiling point | 419.3±45.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) | | form | Thick Oil to Solid | | color | Off-White to Yellow | | InChI | InChI=1S/C15H15NO5/c1-9-6-12(17)8-13(14(9)15(18)21-2)10-4-3-5-11(7-10)16(19)20/h3-7,13-14H,8H2,1-2H3 | | InChIKey | DRIQTXKHWGPNKI-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)C(C2=CC=CC([N+]([O-])=O)=C2)CC(=O)C=C1C |
| | Nifedipine Impurity 9 Usage And Synthesis |
| Uses | Methyl 2-Methyl-6-(3-nitrophenyl)-4-oxo-2-cyclohexene-1-carboxylate is a nicardipine impurity. Also, it is derived from Methyl Acetoacetate (O848425), which is a chemical reagent used in the synthesis of pharmaceuticals. It participates in the Biginelli reaction, forming molecules including dihydropyrimidinones. |
| | Nifedipine Impurity 9 Preparation Products And Raw materials |
|