|
|
| | 5,6,7-TRIMETHOXYFLAVONE Basic information |
| Product Name: | 5,6,7-TRIMETHOXYFLAVONE | | Synonyms: | 5,6,7-TRIMETHOXYFLAVONE;BAICALEIN TRIMETHYL ETHER;BAICALEIN-5,6,7-TRIMETHYL ETHER;5,6,7-Trimethoxyflavone,97%;2-Phenyl-5,6,7-trimethoxy-4H-1-benzopyran-4-one;5,6,7-Trimethoxy-2-phenyl-4H-1-benzopyran-4-one;5,6,7-trimethoxy-2-phenyl-1-benzopyran-4-one;5,6,7-trimethoxy-2-phenyl-chromen-4-one | | CAS: | 973-67-1 | | MF: | C18H16O5 | | MW: | 312.32 | | EINECS: | | | Product Categories: | Tri-substituted Flavones | | Mol File: | 973-67-1.mol |  |
| | 5,6,7-TRIMETHOXYFLAVONE Chemical Properties |
| Melting point | 165-167°C | | Boiling point | 497.4±45.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 33.33 mg/mL (106.72 mM; Need ultrasonic) | | form | Solid | | color | White to light yellow | | InChI | 1S/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 | | InChIKey | HJNJAUYFFFOFBW-UHFFFAOYSA-N | | SMILES | COc1cc2OC(=CC(=O)c2c(OC)c1OC)c3ccccc3 | | LogP | 2.990 (est) | | CAS DataBase Reference | 973-67-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3 |
| Provider | Language |
|
ALFA
| English |
| | 5,6,7-TRIMETHOXYFLAVONE Usage And Synthesis |
| Uses | 5,6,7-Trimethoxyflavone is a novel p38-α MAPK inhibitor with an anti-inflammatory effect. 5,6,7-Trimethoxyflavone is isolated from several plants including Zeyhera tuberculosa, Callicarpa japonica, and Kickxia lanigera[1]. | | Definition | ChEBI: A trimethoxyflavone that is the 5,6,7-trimethyl ether derivative of baicalein. It has been isolated from the plant Callicarpa japonica and has been shown to exhibit antiviral activity. | | References | [1] Hassan AHE, et al. Repurposing mosloflavone/5,6,7-trimethoxyflavone-resveratrol hybrids: Discovery of novel p38-α MAPK inhibitors as potent interceptors of macrophage-dependent production of proinflammatory mediators. Eur J Med Chem. 2019 Jul 9;180:253-267. DOI:10.1016/j.ejmech.2019.07.030 |
| | 5,6,7-TRIMETHOXYFLAVONE Preparation Products And Raw materials |
|