| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
5-ROX, se manufacturers
- 5-ROX, SE
-
- $105.00
-
2026-05-23
- CAS:209734-74-7
- Purity: 95.00%
- Supply Ability: 10g
|
| | 5-ROX, se Basic information |
| Product Name: | 5-ROX, se | | Synonyms: | 9-[2-Carboxy-4-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]phenyl]-2,3,6,7,12,13,16,17-octahydro-1H,5H,11H,15H-xantheno[2,3,4-ij:5,6,7-i'j']diquinolizin-18-ium inner salt;5-ROX, SE [5-Carboxy-X-rhodaMine, succiniMidyl ester];5-Carboxy-X-rhodamin N-succinimidyl ester;5-ROX SE, 5-CXR SE;5-Carboxy-X-rhodamine NHS ester;5-Carboxy-X-rhodamine SE;5(6)-ROX, SE;5-(AND-6)-CARBOXY-X-RHODAMINE, SUCCINIMIDYL ESTER | | CAS: | 209734-74-7 | | MF: | C37H33N3O7 | | MW: | 631.68 | | EINECS: | | | Product Categories: | Biochemicals and Reagents;DetectionFluorescent Stains;Fluorescent Labels;Fluorescent Probes, Labels, Particles and Stains;Nucleic Acid Stains;Nucleic Acid Stains For MicroscopyFluorescent Probes, Labels, Particles and Stains;Rhodamine and Derivatives;ROX | | Mol File: | 209734-74-7.mol |  |
| | 5-ROX, se Chemical Properties |
| storage temp. | −20°C | | solubility | DMF: soluble | | form | powder | | Appearance | dark red solid | | InChIKey | BTTBJYLMDASSAS-UHFFFAOYSA-N | | SMILES | [O-]C(=O)c1cc(ccc1-c2c3cc4CCCN5CCCc(c45)c3[o+]c6c7CCCN8CCCc(cc26)c78)C(=O)ON9C(=O)CCC9=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-ROX, se Usage And Synthesis |
| Description | ROX (rhodamine X) is a bright rhodamine dye for ROX channel. Carboxy rhodamines come as two isomers. This product is a derivative of pure 5-carboxy-ROX. | | Uses | Labeling reagent for preparation of charge-modified dye-labeled ddNTPs for "direct-load" DANN sequencing. | | Chemical Reactivity | Primary amines | | Abs/Em Maxima | 570/591 nm | | Fluoresene quantum yield | 1 | | Extinction Coefficient | 93000 | | CF260 | 0.62 | | CF280 | 0.49 | | Spectrally Similar Dyes | Alexa Fluor® 568, TAMRA, CF™ 568 |
| | 5-ROX, se Preparation Products And Raw materials |
|