| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
(tert-Butylimido)tris(ethylmethylamino)tantalum manufacturers
|
| | (tert-Butylimido)tris(ethylmethylamino)tantalum Basic information |
| | (tert-Butylimido)tris(ethylmethylamino)tantalum Chemical Properties |
| density | 1.323 g/mL at 21 °C (lit.) | | Fp | 64 °F | | form | liquid | | color | yellow | | Sensitive | air sensitive, moisture sensitive | | InChI | InChI=1S/C4H9N.3C3H8N.Ta/c1-4(2,3)5;3*1-3-4-2;/h1-3H3;3*3H2,1-2H3;/q;3*-1;+3 | | InChIKey | PDGHBHKZHSFTHO-UHFFFAOYSA-N | | SMILES | [Ta](N(C)CC)(N(C)CC)(N(C)CC)=NC(C)(C)C |
| | (tert-Butylimido)tris(ethylmethylamino)tantalum Usage And Synthesis |
| General Description | Atomic number of base material: 73 Tantalum | | reaction suitability | core: tantalum reagent type: catalyst |
| | (tert-Butylimido)tris(ethylmethylamino)tantalum Preparation Products And Raw materials |
|