| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
- Methyl myristoleate
-
- $9.00
-
2026-05-28
- CAS:56219-06-8
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 100tons
- Methyl myristoleate
-
- $120.00
-
2025-05-26
- CAS:56219-06-8
- Min. Order: 1mg
- Purity: 0.99
- Supply Ability: 1000
|
| | Methyl myristoleate Basic information |
| Product Name: | Methyl myristoleate | | Synonyms: | METHYL CIS-9-TETRADECENOATE;METHYL MYRISTOLEATE;DELTA 9 CIS TETRADECENOIC ACID METHYL ESTER;C14:1 (CIS-9) METHYL ESTER;METHYL MYRISTOLEATE, STANDARD FOR GC;MYRISTOLEIC ACID METHYL ESTER 99%;METHYLMYRSTOLEATE;Methyl cis-9-tetradecenoate, Myristoleic acid methyl ester | | CAS: | 56219-06-8 | | MF: | C15H28O2 | | MW: | 240.38 | | EINECS: | | | Product Categories: | | | Mol File: | 56219-06-8.mol |  |
| | Methyl myristoleate Chemical Properties |
| Melting point | 52.2℃ | | Boiling point | 306.6±21.0 °C(Predicted) | | density | 0.879±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.446 | | storage temp. | −20°C | | solubility | DMF: 2.5 mg/ml; DMSO: 3 mg/ml; Ethanol: Miscible; PBS (pH 7.2): 2 mg/ml | | form | liquid | | biological source | synthetic (organic) | | BRN | 2046023 | | InChI | 1S/C15H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h6-7H,3-5,8-14H2,1-2H3/b7-6- | | InChIKey | RWIPSJUSVXDVPB-SREVYHEPSA-N | | SMILES | [H]\C(CCCC)=C(/[H])CCCCCCCC(=O)OC |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 10 - Combustible liquids |
| | Methyl myristoleate Usage And Synthesis |
| Chemical Properties | Colorless liquid.Insoluble in water; soluble in alcohol and ether.Combustible. | | Uses | Myristoleic Acid methyl ester is a cytotoxic inducer of apoptosis and necrosis. | | Uses | Methyl myristoleate can be used in medical research andorganic synthesis. | | Definition | The methyl ester of myristoleic acid (cis-tetradec-9-enoic acid). |
| | Methyl myristoleate Preparation Products And Raw materials |
|