|
|
| | Triethyl 1,3,5-benzenetricarboxylate Basic information |
| Product Name: | Triethyl 1,3,5-benzenetricarboxylate | | Synonyms: | TMSSE;TRIMESIC ACID TRIETHYL ESTER;TRIETHYL BENZENE-1,3,5-TRICARBOXYLATE;TRIETHYL 1,3,5-BENZENETRICARBOXYLATE;1,3,5-Benzenetricarboxylic acid, triethyl ester;Triethyl trimesate;BENZENE-1,3,5-TRICARBOXYLIC ACID TRIETHYL ESTER;1,3,5-TRICARBOETHOXYBENZENE | | CAS: | 4105-92-4 | | MF: | C15H18O6 | | MW: | 294.3 | | EINECS: | | | Product Categories: | C12 to C63;Carbonyl Compounds;Esters | | Mol File: | 4105-92-4.mol |  |
| | Triethyl 1,3,5-benzenetricarboxylate Chemical Properties |
| Melting point | 134-139 °C (lit.) | | Boiling point | 140-170 °C(Press: 0.4-0.45 Torr) | | density | 1.1850 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C15H18O6/c1-4-19-13(16)10-7-11(14(17)20-5-2)9-12(8-10)15(18)21-6-3/h7-9H,4-6H2,1-3H3 | | InChIKey | KXGOWZRHSOJOLF-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc(cc(c1)C(=O)OCC)C(=O)OCC | | CAS DataBase Reference | 4105-92-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3,5-Benzenetricarboxylic acid, triethyl ester(4105-92-4) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Triethyl 1,3,5-benzenetricarboxylate Usage And Synthesis |
| | Triethyl 1,3,5-benzenetricarboxylate Preparation Products And Raw materials |
|