|
|
| | 5,6-Dimethoxy-1-indanone Basic information |
| Product Name: | 5,6-Dimethoxy-1-indanone | | Synonyms: | 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy-;5,6-Dimethoxy-2,3-dihydro-1H-indene-1-one;Donepezil Impurity 25;5,6-Dimethoxyindan-1-indanone;2,3-dihydro-5,6-dimethoxyinden-1-one;5,6-Dimethoxyindan-1-one 98%;5,6-Dimethoxy-1-inda;2,3-Dihydro-5,6-diMethoxy- | | CAS: | 2107-69-9 | | MF: | C11H12O3 | | MW: | 192.21 | | EINECS: | 218-287-8 | | Product Categories: | API intermediates;Indanone & Indene;Aromatics Compounds;Intermediates of Donepezil;Aromatics;C11 to C12;Carbonyl Compounds;Ketones;Indane/Indanone and Derivatives;Intermediates;2107-69-9;Pharmaceutical Intermediates | | Mol File: | 2107-69-9.mol |  |
| | 5,6-Dimethoxy-1-indanone Chemical Properties |
| Melting point | 118120°C | | Boiling point | 139 °C / 2mmHg | | density | 1.1503 (rough estimate) | | refractive index | 1.4600 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | Off-White to Pale Yellow | | BRN | 1241095 | | InChI | InChI=1S/C11H12O3/c1-13-10-5-7-3-4-9(12)8(7)6-11(10)14-2/h5-6H,3-4H2,1-2H3 | | InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(OC)C(OC)=C2)CC1 | | CAS DataBase Reference | 2107-69-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Indanone, 5,6-dimethoxy-,(2107-69-9) | | EPA Substance Registry System | 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy- (2107-69-9) |
| | 5,6-Dimethoxy-1-indanone Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 5,6-Dimethoxy-1-indanone can be an intermediate useful in the preparation of Donepezil. | | Uses | 5,6-Dimethoxy-1-indanone was used in the synthesis of 2,3-dimethoxy-11H-indeno[1,2-b]quinoline-6,10-dicarboxylic acid. | | General Description | Thiosemicarbazone derived from 5,6-dimethoxy-1-indanone inhibits bovine viral diarrhea virus infection. | | Purification Methods | Crystallise the indanone from MeOH, then sublime it in a vacuum. [Beilstein 8 IV 1985.] |
| | 5,6-Dimethoxy-1-indanone Preparation Products And Raw materials |
|