|
|
| | 4-BROMO-2-CHLORO-6-(TRIFLUOROMETHYL)ANI& Basic information |
| | 4-BROMO-2-CHLORO-6-(TRIFLUOROMETHYL)ANI& Chemical Properties |
| density | 1.769 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.545(lit.) | | storage temp. | 2-8°C, protect from light | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C7H4BrClF3N/c8-3-1-4(7(10,11)12)6(13)5(9)2-3/h1-2H,13H2 | | InChIKey | GAOGWONUOUYZFD-UHFFFAOYSA-N | | SMILES | Nc1c(Cl)cc(Br)cc1C(F)(F)F |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-BROMO-2-CHLORO-6-(TRIFLUOROMETHYL)ANI& Usage And Synthesis |
| | 4-BROMO-2-CHLORO-6-(TRIFLUOROMETHYL)ANI& Preparation Products And Raw materials |
|