| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | SODIUM NICOTINATE Basic information |
| | SODIUM NICOTINATE Chemical Properties |
| Melting point | >300℃ | | form | powder to crystal | | color | White | | InChI | InChI=1S/C6H5NO2.Na.H/c8-6(9)5-2-1-3-7-4-5;;/h1-4H,(H,8,9);; | | InChIKey | VKASAVRWDBEMDN-UHFFFAOYSA-N | | SMILES | C(C1=CN=CC=C1)(=O)O.[NaH] | | CAS DataBase Reference | 54-86-4(CAS DataBase Reference) | | EPA Substance Registry System | Sodium nicotinate (54-86-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | QT2060000 | | TSCA | TSCA listed | | HS Code | 2933.39.9200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | SODIUM NICOTINATE Usage And Synthesis |
| Chemical Properties | Cristalline powder | | Uses | Sodium nicotinate is an intermediate for the cosmetic and the pharmaceutical industry. Product Data Sheet |
| | SODIUM NICOTINATE Preparation Products And Raw materials |
|