| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4,6-Triisopropylbenzoic acid Basic information |
| Product Name: | 2,4,6-Triisopropylbenzoic acid | | Synonyms: | Benzoic acid, 2,4,6-tris(1-methylethyl)-;LABOTEST-BB LT00454168;2,4,6-tris(propan-2-yl)benzoic acid;2,4,6-tris(1-methylethyl)benzoic acid;2,4,6-Triisopropylbenzoic acid, 98+%;2,4,6-Triisopropylbenzoic;N-[(Z)-(2-bromo-1-phenylethylidene)amino]-2,4-dinitroaniline;2,4,6-Triisopropyl benzoic acid-97% | | CAS: | 49623-71-4 | | MF: | C16H24O2 | | MW: | 248.36 | | EINECS: | 256-400-2 | | Product Categories: | Benzoic acid | | Mol File: | 49623-71-4.mol |  |
| | 2,4,6-Triisopropylbenzoic acid Chemical Properties |
| Melting point | 184-187°C | | Boiling point | 318.7±41.0 °C(Predicted) | | density | 0.984±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.23±0.10(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Slightly soluble in water. | | BRN | 2372331 | | InChI | InChI=1S/C16H24O2/c1-9(2)12-7-13(10(3)4)15(16(17)18)14(8-12)11(5)6/h7-11H,1-6H3,(H,17,18) | | InChIKey | ULVHAZFBJJXIDO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C | | CAS DataBase Reference | 49623-71-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2,4,6-Triisopropylbenzoic acid Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 2,4,6-Triisopropylbenzoic acid is a hindered acid intermediate compound in organic synthesis. |
| | 2,4,6-Triisopropylbenzoic acid Preparation Products And Raw materials |
|