- P-Tolylsulfonglurea
-
- $10.00 / 1KG
-
2025-09-25
- CAS:1694-06-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Methylphenylsulfonylurea Basic information |
| | 4-Methylphenylsulfonylurea Chemical Properties |
| Melting point | 196-198 °C | | density | 1.3844 (rough estimate) | | refractive index | 1.5690 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.07±0.10(Predicted) | | color | White to Off-White | | Water Solubility | 777.9mg/L(37 ºC) | | InChI | InChI=1S/C8H10N2O3S/c1-6-2-4-7(5-3-6)14(12,13)10-8(9)11/h2-5H,1H3,(H3,9,10,11) | | InChIKey | RUTYWCZSEBLPAK-UHFFFAOYSA-N | | SMILES | C1(S(NC(N)=O)(=O)=O)=CC=C(C)C=C1 | | CAS DataBase Reference | 1694-06-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 45-36/37/39-26 | | WGK Germany | WGK 3 | | HS Code | 2935.90.9500 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | 4-Methylphenylsulfonylurea Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 4-Methylphenylsulfonylurea can be used as pharmaceutical intermediate. | | Uses | 4-Methylphenylsulfonylurea is used in the synthesis of Glyburide (G598350), a second generation sulfonylurea with hypoglycemic activity. Glyburide is an antidiabetic agent. | | Uses | N-(p-Toluenesulfonyl)urea is used in the synthesis of Glyburide (G598350), a second generation sulfonylurea with hypoglycemic activity. Glyburide is an antidiabetic agent. |
| | 4-Methylphenylsulfonylurea Preparation Products And Raw materials |
|