| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Chloro-4-methylbenzoic acid Basic information |
| | 3-Chloro-4-methylbenzoic acid Chemical Properties |
| Melting point | 208 °C | | Boiling point | 105-107 °C(Press: 6.5 Torr) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 4.00±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C8H7ClO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) | | InChIKey | SDKUOEOJAXGCLU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C)C(Cl)=C1 | | CAS DataBase Reference | 5162-82-3(CAS DataBase Reference) | | NIST Chemistry Reference | P-toluic acid, 3-chloro-(5162-82-3) |
| Provider | Language |
|
ALFA
| English |
| | 3-Chloro-4-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder |
| | 3-Chloro-4-methylbenzoic acid Preparation Products And Raw materials |
|