- 1,2,3,4-Tetrafluorobenzene
-
- $100.00 / 1KG
-
2025-09-25
- CAS:551-62-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1,2,3,4-Tetrafluorobenzene Basic information |
| Product Name: | 1,2,3,4-Tetrafluorobenzene | | Synonyms: | 2,3,4,5-Tetrafluorobenzene;benzene,1,2,3,4-tetrafluoro-;o-Tetrafluorobenzene;Moxifloxacin Impurity 84;1,2,3,4-TETRAFLUOROBENZENE;4-flurobenzoyl chloride;1,2,3,4-Tetrafluorobenzene 99%;1,2,3,4-Tetrafluorbenzol | | CAS: | 551-62-2 | | MF: | C6H2F4 | | MW: | 150.07 | | EINECS: | 208-997-6 | | Product Categories: | Pyridines;Aromatic Halides (substituted);Fluorobenzene;Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 551-62-2.mol |  |
| | 1,2,3,4-Tetrafluorobenzene Chemical Properties |
| Melting point | -42 °C (lit.) | | Boiling point | 95 °C (lit.) | | density | 1.4 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.408(lit.) | | Fp | 69 °F | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.400 | | BRN | 1910024 | | Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H | | InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(F)C(F)=C1F | | CAS DataBase Reference | 551-62-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,2,3,4-tetrafluoro-(551-62-2) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36/37/39-33-7/9 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 |
| | 1,2,3,4-Tetrafluorobenzene Usage And Synthesis |
| Chemical Properties | colourless liquid |
| | 1,2,3,4-Tetrafluorobenzene Preparation Products And Raw materials |
| Raw materials | 1,2,3,5-Tetrafluorobenzene-->Bromopentafluorobenzene-->Tetrafluorophthalic acid-->Pentafluorobenzene-->hexafluorobenzene-->2,3,4,5-Tetrafluorobenzoic acid | | Preparation Products | 1,2,4,5-Tetrafluorobenzene-->1,3,5-Trifluorobenzene-->1,2-DIIODOTETRAFLUOROBENZENE-->2,3,4,5-Tetrafluorobenzaldehyde-->1-BROMO-2,3,4,5-TETRAFLUOROBENZENE |
|