| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Aminophenylsulfur pentafluoride manufacturers
|
| | 3-Aminophenylsulfur pentafluoride Basic information |
| | 3-Aminophenylsulfur pentafluoride Chemical Properties |
| Melting point | 35 °C | | Boiling point | 87 °C / 3.2mmHg | | storage temp. | Refrigerator | | solubility | Soluble in methanol. | | form | crystals | | pka | 2.86±0.10(Predicted) | | color | Light brown | | Henry's Law Constant | 6.4×100 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | InChI=1S/C6H6F5NS/c7-13(8,9,10,11)6-3-1-2-5(12)4-6/h1-4H,12H2 | | InChIKey | NUFLICUHOXHWER-UHFFFAOYSA-N | | SMILES | C1(S(F)(F)(F)(F)F)=CC=CC(N)=C1 |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 9-26-36/37-60 | | RIDADR | UN2811 | | Hazard Note | Irritant | | TSCA | No | | HazardClass | CORROSIVE | | HazardClass | 6.1 | | HS Code | 2930909899 |
| | 3-Aminophenylsulfur pentafluoride Usage And Synthesis |
| Uses | Reduction of pentafluoroaniline (PFA) leads to rapid fluoride elimination to form the aminotetrafluorophenyl radical. Homolytic reactions of perfluoroaromatic compounds(Formation of pentafluorophenyl radicals from pentafluoroaniline, and their reactions with aromatic compounds). |
| | 3-Aminophenylsulfur pentafluoride Preparation Products And Raw materials |
|