|
|
| | 4-Aminophenylsulfur pentafluoride Basic information |
| | 4-Aminophenylsulfur pentafluoride Chemical Properties |
| Melting point | 64 °C | | storage temp. | Refrigerator | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.17±0.10(Predicted) | | color | White to Light yellow to Light orange | | Henry's Law Constant | 4.0×100 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | InChI=1S/C6H6F5NS/c7-13(8,9,10,11)6-3-1-5(12)2-4-6/h1-4H,12H2 | | InChIKey | MZGZUHNSMNNSRJ-UHFFFAOYSA-N | | SMILES | S(C1C=CC(N)=CC=1)(F)(F)(F)(F)F | | CAS DataBase Reference | 2993-24-0 |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37 | | RIDADR | 2811 | | Hazard Note | Irritant | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 |
| | 4-Aminophenylsulfur pentafluoride Usage And Synthesis |
| Chemical Properties | Light yellow to red-yellow solid | | Application | 4-AMINOPHENYLSULFUR PENTAFLUORIDE is a useful research chemical. |
| | 4-Aminophenylsulfur pentafluoride Preparation Products And Raw materials |
|