| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone Basic information |
| Product Name: | 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone | | Synonyms: | 2,2,2-TRIFLUORO-2',4'-DIMETHOXYACETOPHENONE;Ethanone, 1-(2,4-dimethoxyphenyl)-2,2,2-trifluoro-;1-(2,4-Dimethoxyphenyl)-2,2,2-trifluoroethan-1-one;1-(2,4-Dimethoxyphenyl)-2,2,2-trifluoroethan-1-one - [D92568];2',4'-Dimethoxy-2,2,2-trifluoroacetophenone | | CAS: | 578-16-5 | | MF: | C10H9F3O3 | | MW: | 234.17 | | EINECS: | | | Product Categories: | Building Blocks;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;C10;Carbonyl Compounds;Ketones | | Mol File: | 578-16-5.mol |  |
| | 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone Chemical Properties |
| Melting point | 48-52 °C(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | 1S/C10H9F3O3/c1-15-6-3-4-7(8(5-6)16-2)9(14)10(11,12)13/h3-5H,1-2H3 | | InChIKey | SLMOFSKRLCGLIX-UHFFFAOYSA-N | | SMILES | COc1ccc(c(OC)c1)C(=O)C(F)(F)F |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone Usage And Synthesis |
| | 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone Preparation Products And Raw materials |
|