4'-Methoxy-2,2,2-trifluoroacetophenone manufacturers
|
| | 4'-Methoxy-2,2,2-trifluoroacetophenone Basic information |
| Product Name: | 4'-Methoxy-2,2,2-trifluoroacetophenone | | Synonyms: | P-METHOXY-A,A,A-TRIFLUOROACETOPHENONE;2,2,2-TRIFLUORO-1-(4-METHOXY-PHENYL)-ETHANONE;4-(TRIFLUOROACETYL)ANISOLE;Ethanone, 2,2,2-trifluoro-1-(4-methoxyphenyl)- (9CI);4'-Methoxy-2,2,2-trifluoroacetophenone
4-(Trifluoroacetyl)anisole;2,2,2-Trifluoro-4'-methoxyacetophenone, 97.5%;2,2,2,2-trifluoro-4'-methoxyacetophenone;Ethanone, 2,2,2-trifluoro-1-(4-methoxyphenyl)- | | CAS: | 711-38-6 | | MF: | C9H7F3O2 | | MW: | 204.15 | | EINECS: | | | Product Categories: | ACETYLHALIDE | | Mol File: | 711-38-6.mol |  |
| | 4'-Methoxy-2,2,2-trifluoroacetophenone Chemical Properties |
| Melting point | 267-268 °C | | Boiling point | 64°C/0.5mm | | density | 1.32 | | refractive index | 1.4970 to 1.5020 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Yellow | | InChI | InChI=1S/C9H7F3O2/c1-14-7-4-2-6(3-5-7)8(13)9(10,11)12/h2-5H,1H3 | | InChIKey | NCJZVRPXSSYDBG-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC)C=C1)C(F)(F)F | | CAS DataBase Reference | 711-38-6(CAS DataBase Reference) |
| | 4'-Methoxy-2,2,2-trifluoroacetophenone Usage And Synthesis |
| Chemical Properties | Clear light yellow to yellow liquid | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 29, p. 322, 1986 DOI: 10.1021/jm00153a004 |
| | 4'-Methoxy-2,2,2-trifluoroacetophenone Preparation Products And Raw materials |
|