|
|
| | 2,4-Dimethoxyacetophenone Basic information |
| Product Name: | 2,4-Dimethoxyacetophenone | | Synonyms: | 2,4-DIMETHOXYACETOPHENONE;2,4'-Dimethoxyacetaphenone;2',4'-Dimethoxyacethophenone, 98%;1-Acetyl-2,4-dimethoxybenzene;2',4'-Dimethoxyacetophenone,98%;AKOS BBS-00004235;1-(2,4-Dimethoxy-phenyl)-ethanone;Acetophenone, 2',4'-dimethoxy- | | CAS: | 829-20-9 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | 212-587-2 | | Product Categories: | Building Blocks;C10;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks;Aromatic Acetophenones & Derivatives (substituted);Acetophenone series;829-20-9 | | Mol File: | 829-20-9.mol |  |
| | 2,4-Dimethoxyacetophenone Chemical Properties |
| Melting point | 37-40 °C(lit.) | | Boiling point | 288 °C(lit.) | | density | 1.1272 (rough estimate) | | refractive index | 1.5430 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Dichloromethane, Ethyl Acetate, Methanol | | form | Crystalline Powder | | color | White to off-white | | Sensitive | Light Sensitive | | BRN | 511947 | | InChI | InChI=1S/C10H12O3/c1-7(11)9-5-4-8(12-2)6-10(9)13-3/h4-6H,1-3H3 | | InChIKey | VQTDPCRSXHFMOL-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC)C=C1OC)C | | CAS DataBase Reference | 829-20-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2',4'-Dimethoxyacetophenone(829-20-9) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids |
| | 2,4-Dimethoxyacetophenone Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | 2',4'-Dimethoxyacetophenone-d6 is an by-product in the synthesis of Paeonol-d3 (P133842). Paeonol-d3 is a labelled analogue of Paeonol (P133840), acting as a b-Secretase inhibitor an anti-apoptotic agent is used in the treatment of memory loss after ischemic stroke. Anti-inflammatory and analgesic. | | Preparation | Obtained by reaction of dimethyl sulfate with resacetophenone in the presence of 10% aqueous sodium hydroxide (61%). | | Definition | ChEBI: 2,4-Dimethoxyacetophenone is an aromatic ketone. |
| | 2,4-Dimethoxyacetophenone Preparation Products And Raw materials |
|