(R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE manufacturers
|
| | (R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE Basic information |
| Product Name: | (R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE | | Synonyms: | HYTRA;R-HYTRA;(R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANDIOL-2-ACETAT;(R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL 2-ACETATE;(R)-(+)-1,1,2-TRIPHENYLETHYLENGLYKOL-2-ACETAT;(R)-(+)-ACETIC ACID 2-HYDROXY-1,2,2-TRIPHENYLETHYL ESTER;(R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE;(R)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE | | CAS: | 95061-47-5 | | MF: | C22H20O3 | | MW: | 332.39 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Esters;Organic Building Blocks;Chiral Compound;chiral | | Mol File: | 95061-47-5.mol |  |
| | (R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE Chemical Properties |
| Melting point | 237-240 °C(lit.) | | Boiling point | 429.52°C (rough estimate) | | density | 1.1079 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | sol pyridine, boiling toluene; slightly sol THF, chloroform, cold toluene | | pka | 12.40±0.29(Predicted) | | form | powder | | Optical Rotation | [α]20/D +212°, c = 1 in pyridine | | InChI | 1S/C22H20O3/c1-17(23)25-21(18-11-5-2-6-12-18)22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,24H,1H3/t21-/m1/s1 | | InChIKey | GXLZCXZLVDUDHP-OAQYLSRUSA-N | | SMILES | CC(=O)O[C@H](c1ccccc1)C(O)(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 95061-47-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29153900 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | (R)-(+)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE Preparation Products And Raw materials |
|