| Company Name: |
SHANG FLUORO Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_1@163.com |
|
| | Pentafluorobenzoyl chloride Basic information |
| | Pentafluorobenzoyl chloride Chemical Properties |
| Boiling point | 158-159 °C(lit.) | | density | 1.601 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | None | | storage temp. | Store below +30°C. | | solubility | soluble in Chloroform | | form | Liquid | | Specific Gravity | 1.601 | | color | Clear colorless to light yellow | | Water Solubility | decomposes | | Sensitive | Lachrymatory | | BRN | 2054397 | | Stability: | Moisture Sensitive | | InChI | 1S/C7ClF5O/c8-7(14)1-2(9)4(11)6(13)5(12)3(1)10 | | InChIKey | MYHOHFDYWMPGJY-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c(c(F)c1F)C(Cl)=O | | CAS DataBase Reference | 2251-50-5(CAS DataBase Reference) | | NIST Chemistry Reference | Pentafluorobenzoyl chloride(2251-50-5) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | Hazard Note | Corrosive/Lachrymator | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Pentafluorobenzoyl chloride Usage And Synthesis |
| Description | Pentafluorobenzoyl chloride is the acid chloride of pentafluorobenzoic acid. It is a sensitive derivatising reagent for the analysis of amines, amides and phenols by electron capture gas chromatography. It has a role as a chromatographic reagent. It is an acyl chloride and a perfluorinated compound. It derives from a pentafluorobenzoic acid.
2,3,4,5,6-Pentafluorobenzoyl chloride was used for derivatization of 5-androstenediol, testosterone, estradiol , dihydrotestosterone and estrone in a study to determine their serum levels. 2,3,4,5,6-Pentafluorobenzoyl chloride was used to derivatize dimethylamine(DMA) in study to develop a rapid and accurate GC–MS method for determination of DMA in human urine. 2,3,4,5,6-Pentafluorobenzoyl chloride was used in a study to detect the presence of Enterobacter cloacae in cultures of Leuconostoc mesenteroide by gas chromatography/mass spectrometry. | | Chemical Properties | clear colorless to light yellow liquid | | Uses | Pentafluorobenzoyl Chloride is a useful analytical reagent in the derivatization amphetamines as well as other primary amines. | | Uses | A reagent used for deriving primary amines. 2,3,4,5,6-Pentafluorobenzoyl chloride was used for derivatization of 5-androstenediol, testosterone, estradiol , dihydrotestosterone and estrone in a study to determine their serum levels. 2,3,4,5,6-Pentafluorobenzoyl chloride was used to derivative dimethylamine(DMA) in study to develop a rapid and accurate GC-MS method for determination of DMA in human urine. It was used in a study to detect the presence of Enterobacter cloacae in cultures of Leuconostoc mesenteroide by gas chromatography/mass spectrometry. | | Uses | Pentafluorobenzoyl chloride can be used for the derivatization of a variety of analytes including biological amines. There is an extensive use for the derivatization of lipids. | | Definition | ChEBI: The acid chloride of pentafluorobenzoic acid. It is a sensitive derivatising reagent for the analysis of amines, amides and phenols by electron capture gas chromatography. |
| | Pentafluorobenzoyl chloride Preparation Products And Raw materials |
|