|
|
| | 2,3-DIMETHYL-4-NITROANISOLE Basic information |
| | 2,3-DIMETHYL-4-NITROANISOLE Chemical Properties |
| Melting point | 70-73 °C(lit.) | | Boiling point | 314.29°C (rough estimate) | | density | 1.2375 (rough estimate) | | refractive index | 1.5270 (estimate) | | storage temp. | Store at room temperature | | Appearance | Light yellow to yellow Powder | | InChI | 1S/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 | | InChIKey | DUBFMQLUMHKYOX-UHFFFAOYSA-N | | SMILES | COc1ccc(c(C)c1C)[N+]([O-])=O | | CAS DataBase Reference | 81029-03-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29093090 | | Storage Class | 13 - Non Combustible Solids |
| | 2,3-DIMETHYL-4-NITROANISOLE Usage And Synthesis |
| Chemical Properties | light beige-green powder and chunks | | Uses | 2,3-Dimethyl-4-nitroanisole was used:
- as starting material in the synthesis of conformationally restricted derivatives of lavendustin A
- in the synthesis of 1,4-piperazine-2,5-diones
|
| | 2,3-DIMETHYL-4-NITROANISOLE Preparation Products And Raw materials |
|