| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | p-Tolyl benzoate Basic information |
| Product Name: | p-Tolyl benzoate | | Synonyms: | 4-cresylbenzoate;Benzoic acid, 4-tolyl ester;Benzoic acid, p-tolyl ester;Benzoicacid,4-methylphenylester;benzoicacid,p-tolylester;p-cresolbenzoate;p-Cresyl benzoate;p-cresylbenzoate | | CAS: | 614-34-6 | | MF: | C14H12O2 | | MW: | 212.24 | | EINECS: | 210-380-1 | | Product Categories: | | | Mol File: | 614-34-6.mol |  |
| | p-Tolyl benzoate Chemical Properties |
| Melting point | 70-72 °C (lit.) | | Boiling point | 316°C (estimate) | | density | 1.1035 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 | | InChIKey | LLRZUDIHEZXFGV-UHFFFAOYSA-N | | SMILES | Cc1ccc(OC(=O)c2ccccc2)cc1 | | LogP | 3.590 | | EPA Substance Registry System | p-Tolyl benzoate (614-34-6) |
| WGK Germany | 2 | | RTECS | DH7050000 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | p-Tolyl benzoate Usage And Synthesis |
| Chemical Properties | p-Tolyl Benzoate is a colorless or white plate crystals. M.P. 72℃. BP. 316℃. Insoluble in water, modestly soluble in alcohol, miscible with most perfume oils. Very faint odor, somewhat sweeter than that
of para-Cresylsalicy late, more floral. | | Uses | p-Tolyl Benzoate is rarely used in perfumes, occasionally as a
fixative-modifier in Lily -Jasmin-Narcissus type
bases. | | Preparation | From para-Cresol sodium and Benzoyl chloride. | | General Description | 4-Methylphenyl benzoate is an ester. Structure of 4-methylphenyl benzoate resembles phenyl benzoate and 4-methoxy-phenyl benzoate, in terms of similar geometric parameters. The dihedral angle between the phenyl and benzene rings in 4-methylphenyl benzoate is 60.17 (7)°. Fries rearrangement of 4-methoxy-phenyl benzoate catalyzed by sulfated zirconia is reported. | | Safety Profile | Moderately toxic by
ingestion. A skin irritant. When heated to
decomposition it emits acrid smoke and
irritating fumes. |
| | p-Tolyl benzoate Preparation Products And Raw materials |
|