(-)-3-Demethylcolchicine manufacturers
|
| | (-)-3-Demethylcolchicine Basic information |
| Product Name: | (-)-3-Demethylcolchicine | | Synonyms: | (-)-3-Demethylcolchicine;(S)-7-Acetylamino-6,7-dihydro-3-hydroxy-1,2,10-trimethoxybenzo[a]heptalen-9(5H)-one;3-O-Demethylcolchicine;3-DesMethylcolchicine;N-[(7S)-5,6,7,9-Tetrahydro-3-hydroxy-1,2,10-triMethoxy-9-oxobenzo[a]heptalen-7-yl]-acetaMide;N-[[(7S)-3-Hydroxy-1,2,10-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalene]-7α-yl]acetamide;O3-Demethylcolchicine;Colchicine EP Impurity E | | CAS: | 7336-33-6 | | MF: | C21H23NO6 | | MW: | 385.41 | | EINECS: | | | Product Categories: | Chiral Reagents;Inhibitors;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 7336-33-6.mol |  |
| | (-)-3-Demethylcolchicine Chemical Properties |
| Melting point | 163-166°C | | Boiling point | 768.3±60.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO : 100 mg/mL (259.46 mM; Need ultrasonic) | | form | A solid | | pka | 9.53±0.40(Predicted) | | color | White to yellow | | InChI | InChI=1S/C21H23NO6/c1-11(23)22-15-7-5-12-9-17(25)20(27-3)21(28-4)19(12)13-6-8-18(26-2)16(24)10-14(13)15/h6,8-10,15,25H,5,7H2,1-4H3,(H,22,23)/t15-/m0/s1 | | InChIKey | JRRUSQGIRBEMRN-HNNXBMFYSA-N | | SMILES | C(N[C@@H]1C2C(C3=C(OC)C(OC)=C(O)C=C3CC1)=CC=C(OC)C(=O)C=2)(=O)C |
| Toxicity | LD50 intraperitoneal in mouse: 570ug/kg |
| | (-)-3-Demethylcolchicine Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | A metabolite of Colchicine (C640000). Has shown anti-tumor activity. |
| | (-)-3-Demethylcolchicine Preparation Products And Raw materials |
|