|
|
| | 2-Hydroxyisonicotinic acid Basic information |
| | 2-Hydroxyisonicotinic acid Chemical Properties |
| Melting point | 300 | | Boiling point | 384.0±42.0 °C(Predicted) | | density | 1.451±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | pka | 2+-.0.20(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C6H5NO3/c8-5-3-4(6(9)10)1-2-7-5/h1-3H,(H,7,8)(H,9,10) | | InChIKey | BXHCJLRTXPHUGH-UHFFFAOYSA-N | | SMILES | C1(=O)NC=CC(C(O)=O)=C1 | | CAS DataBase Reference | 22282-72-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 2-Hydroxyisonicotinic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Used in the synthesis of selective inhibitors of neuropeptide Y Y5 inhibiting food intake. Also used in the optimization of p-subsite residues of HIV protease inhibitors. | | Synthesis Reference(s) | Tetrahedron Letters, 29, p. 4389, 1988 DOI: 10.1016/S0040-4039(00)80502-X |
| | 2-Hydroxyisonicotinic acid Preparation Products And Raw materials |
|