| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:8-(trifluoromethyl)-9H-purin-6-amine CAS:2993-05-7
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:2993-05-7 Purity:AldrichCPR
|
|
| | 8-(TRIFLUOROMETHYL)-9H-PURIN-6-AMINE Basic information |
| | 8-(TRIFLUOROMETHYL)-9H-PURIN-6-AMINE Chemical Properties |
| form | solid | | InChI | 1S/C6H4F3N5/c7-6(8,9)5-13-2-3(10)11-1-12-4(2)14-5/h1H,(H3,10,11,12,13,14) | | InChIKey | LMWFSHBVFKCMHW-UHFFFAOYSA-N | | SMILES | Nc1ncnc2[nH]c(nc12)C(F)(F)F |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 8-(TRIFLUOROMETHYL)-9H-PURIN-6-AMINE Usage And Synthesis |
| Definition | ChEBI: 8-(Trifluoromethyl)-9H-purin-6-amine is a member of 6-aminopurines. It has a role as an anticoronaviral agent. |
| | 8-(TRIFLUOROMETHYL)-9H-PURIN-6-AMINE Preparation Products And Raw materials |
|