| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2,2'-Dihydroxychalcone manufacturers
|
| | 2,2'-Dihydroxychalcone Basic information |
| Product Name: | 2,2'-Dihydroxychalcone | | Synonyms: | 1,3-bis(2-hydroxyphenyl)-2-propen-1-on;1,3-bis(2-hydroxyphenyl)-2-propen-1-one;2’-hydroxy-3-(o-hydroxyphenyl)-acrylophenon;2-Propen-1-one, 1,3-bis(2-hydroxyphenyl)-;Acrylophenone, 2'-hydroxy-3-(o-hydroxyphenyl)-;Chalcone, 2,2'-dihydroxy- (6ci,7ci,8ci);1,3-Bis-(2-hydroxyphenyl)prop-2-en-1-one;(E)-1,3-bis(2-hydroxyphenyl)prop-2-en-1-one | | CAS: | 15131-80-3 | | MF: | C15H12O3 | | MW: | 240.25 | | EINECS: | | | Product Categories: | Chalcones | | Mol File: | 15131-80-3.mol |  |
| | 2,2'-Dihydroxychalcone Chemical Properties |
| Melting point | 161-162°C | | Boiling point | 447.1±45.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | pka | 7.72±0.30(Predicted) | | form | solid | | InChI | 1S/C15H12O3/c16-13-7-3-1-5-11(13)9-10-15(18)12-6-2-4-8-14(12)17/h1-10,16-17H/b10-9+ | | InChIKey | KSHCTKZLHCSARH-MDZDMXLPSA-N | | SMILES | Oc1ccccc1\C=C\C(=O)c2ccccc2O |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| | 2,2'-Dihydroxychalcone Usage And Synthesis |
| Uses | 2,2′-Dihydroxychalcone, a flavonoid, is a glutathione S-transferase (GST) inhibitor with an IC50 of 28.9 μM in human colon cancer cells. 2,2′-Dihydroxychalcone induces cell cycle arrest and apoptosis in prostate cancer cells. 2,2′-Dihydroxychalcone has anticancer and anti-inflammatory properties[1][2]. | | References | [1] Ahmed Q Haddad, et al. Antiproliferative mechanisms of the flavonoids 2,2'-dihydroxychalcone and fisetin in human prostate cancer cells. Nutr Cancer. 2010;62(5):668-81. DOI:10.1080/01635581003605524
[2] Kenneth Goh, et al. 2,2'-Dihydroxychalcone, a glutathione transferase inhibitor, sensitises human colon adenocarcinoma cells to chlorambucil and melphalan, but not to actinomycin D. Mol Med Rep. 2008 Jul-Aug;1(4):575-9. PMID:21479453 |
| | 2,2'-Dihydroxychalcone Preparation Products And Raw materials |
|