| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
- Formoterol Impurity
-
-
2025-12-16
- CAS:532414-36-1
- Min. Order: 10mg
- Purity: 98
- Supply Ability: 1000000000000
|
| | Formoterol Fumarate Dihydrate EP Impurity I Basic information |
| Product Name: | Formoterol Fumarate Dihydrate EP Impurity I | | Synonyms: | Formoterol impurity 9/Formoterol EP Impurity I/rel-N-(2-Hydroxy-5-((R)-1-hydroxy-2-(((S)-1-(4-methoxyphenyl)propan-2-yl)amino)ethyl)phenyl)formamide;Formoterol Impurity 9(Formoterol EP Impurity I);anti-rac-Formoterol;Formoterol Fumarate Impurity Ⅰ:rel-(R,S)-Formoterol;rel-N-[2-Hydroxy-5-[(1R)-1-hydroxy-2-[[(1S)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide;Arformoterol Impurity 22;N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide;N-(2-hydroxy-5-((R)-1-hydroxy-2-(((S)-1-(4-methoxyphenyl)propan-2-yl)amino)ethyl)phenyl)formamide | | CAS: | 532414-36-1 | | MF: | C19H24N2O4 | | MW: | 344.41 | | EINECS: | | | Product Categories: | | | Mol File: | 532414-36-1.mol |  |
| | Formoterol Fumarate Dihydrate EP Impurity I Chemical Properties |
| Boiling point | 603.2±55.0 °C(Predicted) | | density | 1.233±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.95±0.50(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19-/s3 | | InChIKey | BPZSYCZIITTYBL-XRLMYYCKNA-N | | SMILES | C(NC1=CC([C@@H](O)CN[C@@H](C)CC2=CC=C(OC)C=C2)=CC=C1O)=O |&1:5,9,r| |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Repr. 2 STOT RE 2 STOT SE 1 |
| | Formoterol Fumarate Dihydrate EP Impurity I Usage And Synthesis |
| Uses | rel-(R,S)-Formoterol is a stereoisomer of Formoterol (F693395). Formoterol is a long-acting inhaled beta-2 agonist (bronchodilator) that is used to treat patients with COPD and asthma. |
| | Formoterol Fumarate Dihydrate EP Impurity I Preparation Products And Raw materials |
|