|
|
| | Isopropyl 5-(Diphenylphosphoryl)pentanoate Basic information |
| Product Name: | Isopropyl 5-(Diphenylphosphoryl)pentanoate | | Synonyms: | NUSCAFULQNHZJJ-UHFFFAOYSA-N;Latanoprost Impurity 9;ISOPROPYL DIPHENYLPHOSPHORYL PENTANOATE;Isopropyl 5-(diphenylphosphoryl)pentanoateQ: What is
Isopropyl 5-(diphenylphosphoryl)pentanoate Q: What is the CAS Number of
Isopropyl 5-(diphenylphosphoryl)pentanoate Q: What is the storage condition of
Isopropyl 5-(diphenylphosphoryl)pentanoate Q: What are the applications of
Isopropyl 5-(diphenylphosphoryl)pentanoate;Pentanoic acid, 5-(diphenylphosphinyl)-, 1-methylethyl ester;propan-2-yl 5-(oxodiphenyl-λ5-phosphanyl)pentanoate;Tafluprost Impurity 8(Diphenylphosphine Isopropyl Ester);Latanprost EP Impurity D | | CAS: | 2088449-88-9 | | MF: | C20H25O3P | | MW: | 344.39 | | EINECS: | | | Product Categories: | | | Mol File: | 2088449-88-9.mol |  |
| | Isopropyl 5-(Diphenylphosphoryl)pentanoate Chemical Properties |
| Boiling point | 437.2±28.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 25 mg/ml,DMSO: 25 mg/ml,Ethanol: 50 mg/ml,Ethanol:PBS (pH 7.2) (1:3): 0.25 mg/ml | | form | A crystalline solid | | InChI | InChI=1S/C20H25O3P/c1-17(2)23-20(21)15-9-10-16-24(22,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17H,9-10,15-16H2,1-2H3 | | InChIKey | NUSCAFULQNHZJJ-UHFFFAOYSA-N | | SMILES | C(OC(C)C)(=O)CCCCP(C1=CC=CC=C1)(C1=CC=CC=C1)=O |
| | Isopropyl 5-(Diphenylphosphoryl)pentanoate Usage And Synthesis |
| Description | Latanoprost is the isopropyl ester of 17-phenyl-13,14-dihydro prostaglandin F2α. It is a prodrug of the free acid, which is a potent agonist of the FP receptor in the eye. Isopropyl 5-(diphenylphosphoryl)pentanoate is a potential trace impurity in commercial preparations of latanoprost. | | Uses | Isopropyl 5-(Diphenylphosphoryl)pentanoate, is a derivative of 5-(Diphenylphosphinyl)pentanoic Acid (D492135). |
| | Isopropyl 5-(Diphenylphosphoryl)pentanoate Preparation Products And Raw materials |
|