Bis(2-butoxyethyl) Phthalate-d4 manufacturers
|
| | Bis(2-butoxyethyl) Phthalate-d4 Basic information |
| Product Name: | Bis(2-butoxyethyl) Phthalate-d4 | | Synonyms: | Bis(2-butoxyethyl) Phthalate-d4;[2H4]-Bis (2-butoxyethyl) Phthalate;Bis(2-butoxyethyl) Phthalate-d4 Solution in Hexane, 1000μg/mL;Phthalic acid, bis-2-n-butoxyethyl ester D4;Bis(2-butoxyethyl) phthalate-d;Phthalic acid, bis-2-n-butoxyethyl ester-D4 (Standard) | | CAS: | 1398065-96-7 | | MF: | C6D4(COOCH2CH2OCH2CH2CH2CH3)2 | | MW: | 370.473247112 | | EINECS: | | | Product Categories: | | | Mol File: | 1398065-96-7.mol |  |
| | Bis(2-butoxyethyl) Phthalate-d4 Chemical Properties |
| storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless |
| | Bis(2-butoxyethyl) Phthalate-d4 Usage And Synthesis |
| Uses | Bis(2-butoxyethyl) Phthalate-d4 is labelled Bis(2-butoxyethyl) Phthalate (B415115), a plasticizer. |
| | Bis(2-butoxyethyl) Phthalate-d4 Preparation Products And Raw materials |
|