|
|
| | DI-N-HEXYL PHTHALATE-3,4,5,6-D4 Basic information |
| Product Name: | DI-N-HEXYL PHTHALATE-3,4,5,6-D4 | | Synonyms: | DI-N-HEXYL PHTHALATE-3,4,5,6-D4;Di-n-hexyl phthalate-d4;Dihexyl phthalate-3,4,5,6-d4 Solution, 100ppm;Di-n-hexyl Phthalate-3,4,5,6-d4@100 μg/mL in Methanol;Dihexyl phthalate-3,4,5,6-d4Solution Solution in Hexane, 1000ug/mL;1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, 1,2-dihexyl ester;Di-n-hexyl Phthalate-3,4,5,6-d4
DISCONTINUED PLEASE SEE B185432;Di-n-hexyl phthalate-3,4,5,6-d4 in isooctane | | CAS: | 1015854-55-3 | | MF: | C20H30O4 | | MW: | 334.46 | | EINECS: | 688-239-2 | | Product Categories: | | | Mol File: | Mol File |  |
| | DI-N-HEXYL PHTHALATE-3,4,5,6-D4 Chemical Properties |
| solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless to light yellow | | Major Application | cleaning products
cosmetics
environmental
food and beverages
personal care | | InChI | 1S/C20H30O4/c1-3-5-7-11-15-23-19(21)17-13-9-10-14-18(17)20(22)24-16-12-8-6-4-2/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3/i9D,10D,13D,14D | | InChIKey | KCXZNSGUUQJJTR-LSQQNFJSSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCCCC)c(c1[2H])C(=O)OCCCCCC |
| Hazard Codes | T | | Risk Statements | 61 | | Safety Statements | 53-45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | DI-N-HEXYL PHTHALATE-3,4,5,6-D4 Usage And Synthesis |
| Uses | Dihexylphthalate-d4 is an labeled analog of Dihexylphthalate (B185430), which is a phthalic ester, which is used as a plasticizers for vinyl plastics. Phthalates may be associated with reproductive toxicity in humans and animals. |
| | DI-N-HEXYL PHTHALATE-3,4,5,6-D4 Preparation Products And Raw materials |
|