|
|
| | DICYCLOHEXYL PHTHALATE-3,4,5,6-D4 Basic information |
| Product Name: | DICYCLOHEXYL PHTHALATE-3,4,5,6-D4 | | Synonyms: | DICYCLOHEXYL PHTHALATE-3,4,5,6-D4;DICYCLOHEXYL PHTHALATE-D4;VOWAEIGWURALJQ-ZZRPVTOQSA-N;dicyclohexyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate;Dicyclohexyl Phthalate-3,4,5,6-d4 @100 μg/mL in Methanol;[2H4]-Dicyclohexyl Phthalate;icyclohexyl3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate;Dicyclohexyl phthalate-3,4,5,6-d4 in isooctane | | CAS: | 358731-25-6 | | MF: | C20H22D4O4 | | MW: | 334.44 | | EINECS: | | | Product Categories: | Analytical Standards;AromaticsAnalytical Standards;Chemical Class;EstersAnalytical Standards;Plasticizers;Aromatics, Isotope Labelled Compounds, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 358731-25-6.mol |  |
| | DICYCLOHEXYL PHTHALATE-3,4,5,6-D4 Chemical Properties |
| Melting point | 64-66°C | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | color | White to Off-White | | Major Application | agriculture environmental | | InChI | 1S/C20H26O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2/i7D,8D,13D,14D | | InChIKey | VOWAEIGWURALJQ-ZZRPVTOQSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(=O)OC2CCCCC2)c(c1[2H])C(=O)OC3CCCCC3 |
| WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Chronic 3 Repr. 1B Skin Sens. 1 |
| | DICYCLOHEXYL PHTHALATE-3,4,5,6-D4 Usage And Synthesis |
| Uses | Dicyclohexyl Phthalate-3,4,5,6-d4, a phthalate ester used as a plasticizer as well as being present in cosmetic products. Dicyclohexyl Phthalate that is a weak drug-type inducer of hepatic xenobiotic metabolism. | | Uses | Labelled analogue of Dicyclohexyl Phthalate, a phthalate ester used as a plasticizer as well as being present in cosmetic products. Dicyclohexyl Phthalate that is a weak drug-type inducer of hepatic xenobiotic metabolism. |
| | DICYCLOHEXYL PHTHALATE-3,4,5,6-D4 Preparation Products And Raw materials |
|