- 3',4'-Dimethoxyflavone
-
- $1450.00 / 5g
-
2024-04-02
- CAS:4143-62-8
- Min. Order: 1g
- Purity: 98
- Supply Ability: 500 Kg
- 3',4'-DIMETHOXYFLAVONE
-
- $1.00 / 1KG
-
2019-12-23
- CAS:4143-62-8
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10t
|
| | 3',4'-DIMETHOXYFLAVONE Basic information |
| Product Name: | 3',4'-DIMETHOXYFLAVONE | | Synonyms: | DIMETHOXYFLAVONE, 3',4'-;3-HYDROXY-3',4'DIMETHOXYFLAVONE;3',4'-DIMETHOXY-3-HYDROXYFLAVONE;3',4'-DIMETHOXYFLAVONE;3',4'-DIMETHOXYFLAVONOL;2-(3,4-dimethoxyphenyl)-1-benzopyran-4-one;2-(3,4-Dimethoxyphenyl)chromen-4-one;3′,4′-DMF | | CAS: | 4143-62-8 | | MF: | C17H14O4 | | MW: | 282.29 | | EINECS: | | | Product Categories: | Di-substituted Flavones;Flavanols | | Mol File: | 4143-62-8.mol |  |
| | 3',4'-DIMETHOXYFLAVONE Chemical Properties |
| Melting point | 154-155°C | | Boiling point | 428.5±45.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: ≥20mg/mL | | form | powder | | color | white to off-white | | λmax | 334nm(MeOH)(lit.) | | BRN | 236749 | | InChI | 1S/C17H14O4/c1-19-15-8-7-11(9-17(15)20-2)16-10-13(18)12-5-3-4-6-14(12)21-16/h3-10H,1-2H3 | | InChIKey | ZGHORMOOTZTQFL-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1OC)C2=CC(=O)c3ccccc3O2 | | LogP | 3.650 (est) | | CAS DataBase Reference | 4143-62-8(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 22-24/25-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | RTECS | DJ3012950 | | HS Code | 2932.99.7000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| Provider | Language |
|
ALFA
| English |
| | 3',4'-DIMETHOXYFLAVONE Usage And Synthesis |
| Uses | 3′,4′-Dimethoxyflavone has been used in urease inhibition assay. | | Biochem/physiol Actions | 3′,4′-Dimethoxyflavone is a flavone compound, which has the ability to prevent the production and accumulation of poly (ADP-ribose) (PAR) polymer. It guards against N-methyl-D-aspartate (NMDA) toxicity in cortical neurons. 3′,4′-Dimethoxyflavone is a member of the class of plant-derived polyphenolic flavonoids. It is known to have antioxidant, anti-cancer, anti-inflammatory, anti-atherogenic, hypolipidemic and neuroprotective or neurotrophic effects. |
| | 3',4'-DIMETHOXYFLAVONE Preparation Products And Raw materials |
|