|
|
| | 3',4',5',5,7-Pentamethoxyflavone Basic information |
| Product Name: | 3',4',5',5,7-Pentamethoxyflavone | | Synonyms: | 3',4',5,5',7-PENTAMETHOXYFLAVONE;PENTAMETHOXYFLAVONE, 3',4',5',5,7-;TRICIN 5,7,4'-TRIMETHYL ETHER;3',4',5,5',7-PENTAMETHOXYFLAVONE 97%;PENTAMETHOXYFLAVONE, 3',4',5',5,7-(RG);PROTOPANAXADIOL(P);3',4',5',5,7-Pentamethoxyflavone ,98%;5,7-DiMethoxy-2-(3,4,5-triMethoxyphenyl)-4H-1-benzopyran-4-one | | CAS: | 53350-26-8 | | MF: | C20H20O7 | | MW: | 372.37 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Penta-substituted Flavones;Inhibitors;Tyrosine Kinase Inhibitors | | Mol File: | 53350-26-8.mol |  |
| | 3',4',5',5,7-Pentamethoxyflavone Chemical Properties |
| Melting point | 198-200°C | | Boiling point | 554.4±50.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | solubility | Hot Acetone, Warm Ethanol, Methanol | | form | Solid | | color | Off-White Crystalline | | InChI | InChI=1S/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3 | | InChIKey | GIKVSFNAEBQLGB-UHFFFAOYSA-N | | SMILES | C1(C2=CC(OC)=C(OC)C(OC)=C2)OC2=CC(OC)=CC(OC)=C2C(=O)C=1 | | LogP | 3.060 (est) |
| | 3',4',5',5,7-Pentamethoxyflavone Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | Inhibits ATPase activity and has chemisensitizing effects |
| | 3',4',5',5,7-Pentamethoxyflavone Preparation Products And Raw materials |
|