- BOC-L-3,5-DIFLUOROPHE
-
- $0.00 / 1KG
-
2025-04-04
- CAS:205445-52-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- BOC-L-3,5-DIFLUOROPHE
-
- $1.00 / 1KG
-
2020-01-01
- CAS:205445-52-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | BOC-L-3,5-DIFLUOROPHE Basic information |
| Product Name: | BOC-L-3,5-DIFLUOROPHE | | Synonyms: | N-BOC-3,5-DIFLUORO-L-PHENYLALANINE;Boc-L-Phe(3,5-DiF)-OH;Boc-L-3,5-Difluoro-phe-OH;Boc-Phe(3,5-F2)-OH Boc-3,5-Difluoro-D-Phenylalanine;(2S)-2-{[(tert-butoxy)carbonyl]aMino}-3-(3,5-difluorophenyl)propanoic acid;(S)-N-Boc-3,5-difluorophenylalanine;N-Boc-L-3,5-difluorophenylalanine;(S)-Boc-2-amino-3-(3,5-difluorophenyl)propionic acid | | CAS: | 205445-52-9 | | MF: | C14H17F2NO4 | | MW: | 301.29 | | EINECS: | | | Product Categories: | Phenylalanine analogs and other aromatic alpha amino acids;Amino Acid Derivatives;Peptide;Amino Acids | | Mol File: | 205445-52-9.mol |  |
| | BOC-L-3,5-DIFLUOROPHE Chemical Properties |
| Melting point | 115℃ | | Boiling point | 417.6±45.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.73±0.10(Predicted) | | form | solid | | color | White | | Optical Rotation | -18.6°(C=1.10g/100ml DMSO) | | Major Application | peptide synthesis | | InChI | InChI=1S/C14H17F2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)6-8-4-9(15)7-10(16)5-8/h4-5,7,11H,6H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1 | | InChIKey | CZBNUDVCRKSYDG-NSHDSACASA-N | | SMILES | C(O)(=O)[C@H](CC1=CC(F)=CC(F)=C1)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 205445-52-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-3,5-DIFLUOROPHE Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Used as pharmaceutical intermediates. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-3,5-DIFLUOROPHE Preparation Products And Raw materials |
|