|
|
| | (S)-N-Boc-(4-Pyridyl)alanine Basic information |
| | (S)-N-Boc-(4-Pyridyl)alanine Chemical Properties |
| Boiling point | 409.5°C (rough estimate) | | density | 1.1738 (rough estimate) | | refractive index | 1.6450 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.43±0.10(Predicted) | | color | White to light yellow | | Sensitive | Air & Moisture Sensitive | | BRN | 6417084 | | Major Application | peptide synthesis | | InChI | 1S/C13H18N2O4/c1-13(2,3)19-12(18)15-10(11(16)17)8-9-4-6-14-7-5-9/h4-7,10H,8H2,1-3H3,(H,15,18)(H,16,17)/t10-/m0/s1 | | InChIKey | FNYWDMKESUACOU-JTQLQIEISA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccncc1)C(O)=O | | CAS DataBase Reference | 37535-57-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | F | 1-10 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | (S)-N-Boc-(4-Pyridyl)alanine Usage And Synthesis |
| Chemical Properties | off-white to light yellow powder | | Uses | Boc-3-(4-pyridyl)-L-alanine is the protected form of L-Alanine (A481500), a non-essential amino acid that can be found naturally in the human body and is obtained by our diet. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (S)-N-Boc-(4-Pyridyl)alanine Preparation Products And Raw materials |
|