|
|
| | Boc-3-(2-pyridyl)-L-alanine Basic information |
| | Boc-3-(2-pyridyl)-L-alanine Chemical Properties |
| Melting point | 141 °C(dec.) | | alpha | -16.5 º (c=1% in methanol) | | Boiling point | 409.5°C (rough estimate) | | density | 1.1738 (rough estimate) | | refractive index | 1.6450 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | slightly sol. in Methanol | | pka | 3.09±0.10(Predicted) | | form | Solid | | color | White to Almost white | | Optical Rotation | [α]20/D 16.5±1.5°, c = 1% in methanol | | BRN | 6416850 | | Major Application | peptide synthesis | | InChI | 1S/C13H18N2O4/c1-13(2,3)19-12(18)15-10(11(16)17)8-9-6-4-5-7-14-9/h4-7,10H,8H2,1-3H3,(H,15,18)(H,16,17)/t10-/m0/s1 | | InChIKey | KMODKKCXWFNEIK-JTQLQIEISA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccn1)C(O)=O | | CAS DataBase Reference | 71239-85-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-60-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Boc-3-(2-pyridyl)-L-alanine Usage And Synthesis |
| Chemical Properties | Off-white to beige powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-3-(2-pyridyl)-L-alanine Preparation Products And Raw materials |
|