| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 2-Indanol
-
- $6.00
-
2026-09-02
- CAS:4254-29-9
- Min. Order: 1KG
- Purity: 99%
- 2-Indanol
-
-
2025-04-04
- CAS:4254-29-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- 2-Indanol
-
- $15.00
-
2021-07-13
- CAS:4254-29-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | 2-Indanol Basic information |
| | 2-Indanol Chemical Properties |
| Melting point | 68-71 °C (lit.) | | Boiling point | 120-123 °C (12.0016 mmHg) | | density | 0.8540 (rough estimate) | | refractive index | 1.5200 (estimate) | | Fp | 109 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystaline | | pka | 15.17±0.20(Predicted) | | color | White to Light yellow | | Water Solubility | 6 g/L (20 ºC) | | BRN | 1862567 | | InChI | InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 | | InChIKey | KMGCKSAIIHOKCX-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC=C2)CC1O | | CAS DataBase Reference | 4254-29-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Indanol(4254-29-9) |
| | 2-Indanol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2-Indanamine metabolite. | | General Description | 2-Indanol is stabilized by internal hydrogen bonding in its most stable form. The resonantly enhanced multiphoton ionization (REMPI) and zero kinetic energy (ZEKE) photoelectron spectroscopy of 2-indanol was studied. |
| | 2-Indanol Preparation Products And Raw materials |
|