|
|
| | Fmoc-3-Aminomethylbenzoic acid Basic information |
| | Fmoc-3-Aminomethylbenzoic acid Chemical Properties |
| Boiling point | 631.6±48.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 4.20±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 6825025 | | Major Application | peptide synthesis | | InChI | 1S/C23H19NO4/c25-22(26)16-7-5-6-15(12-16)13-24-23(27)28-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21H,13-14H2,(H,24,27)(H,25,26) | | InChIKey | VODSFAVGEJUBHO-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccc(CNC(=O)OCC2c3ccccc3-c4ccccc24)c1 | | CAS DataBase Reference | 155369-11-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | Fmoc-3-Aminomethylbenzoic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-3-aminomethylbenzoic acid |
| | Fmoc-3-Aminomethylbenzoic acid Preparation Products And Raw materials |
|