|
|
| | 5-METHOXY-2-NITROANILINE Basic information |
| | 5-METHOXY-2-NITROANILINE Chemical Properties |
| Melting point | 131°C | | Boiling point | 337.07°C (rough estimate) | | density | 1.2089 (estimate) | | refractive index | 1.6010 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | -0.61±0.25(Predicted) | | color | Yellow | | λmax | 366nm(Cyclohexane)(lit.) | | InChI | InChI=1S/C7H8N2O3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 | | InChIKey | QEHVRGACCVLLNN-UHFFFAOYSA-N | | SMILES | C1(N)=CC(OC)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 16133-49-6(CAS DataBase Reference) |
| | 5-METHOXY-2-NITROANILINE Usage And Synthesis |
| Uses | 5-Methoxy-2-nitrobenzenamine is used in the synthesis of methoxybenzimidazole compounds as inhibitors of PI3K, used in the therapeutic treatment of cancer. Also used in the synthesis of NR2B-selective NMDA receptor antagonists in the treatment of a range of nervous system disorders |
| | 5-METHOXY-2-NITROANILINE Preparation Products And Raw materials |
|