| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-Dichloronitrobenzene Basic information |
| Product Name: | 3,5-Dichloronitrobenzene | | Synonyms: | 3,5-Dichloronitrobenzene,98%;1,3-dichloro-5-nitro-benzen;3,5-Dichloro-1-nitrobenzene;Benzene, 1,3-dichloro-5-nitro-;m-Dichloronitrobenzene;meta-Dichloronitrobenzene;3,5-DICHLORONITROBENZENE;3,5-DICHLORONITROBENZENE PESTANAL, 250 M | | CAS: | 618-62-2 | | MF: | C6H3Cl2NO2 | | MW: | 192 | | EINECS: | 210-557-3 | | Product Categories: | Pesticides&Metabolites;Chlorine Compounds;Nitro Compounds;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Alpha sort;D;DAlphabetic;DIA - DIC | | Mol File: | 618-62-2.mol |  |
| | 3,5-Dichloronitrobenzene Chemical Properties |
| Melting point | 64-65 °C(lit.) | | Boiling point | 259.71°C (rough estimate) | | density | 1.4000 | | vapor pressure | 1.5-101300Pa at 25-250℃ | | refractive index | 1.4000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystals | | color | Orange to brown | | Water Solubility | insoluble | | BRN | 2208877 | | Henry's Law Constant | 8.4×10-1 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | 1S/C6H3Cl2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H | | InChIKey | RNABGKOKSBUFHW-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(Cl)cc(Cl)c1 | | LogP | 3.09 at 25℃ | | CAS DataBase Reference | 618-62-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Dichloronitrobenzene(618-62-2) | | EPA Substance Registry System | Benzene, 1,3-dichloro-5-nitro- (618-62-2) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36/37-36/37/39-36 | | RIDADR | UN3077 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29049095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2 |
| | 3,5-Dichloronitrobenzene Usage And Synthesis |
| Chemical Properties | Orange to brown crystals | | Uses | 1,3-Dichloro-5-nitrobenzene was used as an internal standard in the 1H nuclear magnetic resonance spectroscopic method for the assay of phenylbutazone and oxyphenbutazone. | | General Description | 1,3-Dichloro-5-nitrobenzene was tested for fungitoxicity against Aspergillus niger, A. oryzae, Trichoderma viride, Myrothecium verrucaria and Trichophyton mentagrophytes. |
| | 3,5-Dichloronitrobenzene Preparation Products And Raw materials |
| Preparation Products | 3,5-Dichloroaniline-->Teflubenzuron-->2,4-Difluoro-3,5-dichloroaniline-->2,4-Difluoro-3,5-dichloronitrobenzene-->2,2',4,4',6,6'-Hexachlorobiphenyl-->2,4-Dichloronitrobenzene-->2,6-dichloro-4-nitrobenzonitrile |
|