- Naphthalene-d8
-
- $0.00 / 1mg
-
2026-04-02
- CAS:1146-65-2
- Min. Order:
- Purity:
- Supply Ability: 10g
- NAPHTHALENE-D8
-
- $0.00 / 1KG
-
2025-12-24
- CAS:1146-65-2
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
|
| | NAPHTHALENE-D8 Basic information |
| | NAPHTHALENE-D8 Chemical Properties |
| Melting point | 80-82 °C(lit.) | | Boiling point | 218 °C(lit.) | | density | 1.242 g/cm3 | | vapor density | 4.4 (vs air) | | vapor pressure | 0.03 mm Hg ( 25 °C) | | refractive index | 1.58075 (589.3 nm 98℃) | | Fp | 174 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystals or Crystalline Powder | | color | White | | explosive limit | 0.9-5.9%(V) | | Stability: | Stable. Incompatible with oxidizing agents. Flammable. | | Major Application | electronics | | InChI | 1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D | | InChIKey | UFWIBTONFRDIAS-PGRXLJNUSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c2c1[2H] | | CAS DataBase Reference | 1146-65-2(CAS DataBase Reference) | | EPA Substance Registry System | Naphthalene-d8 (1146-65-2) | | CAS Number Unlabeled | 91-20-3 |
| Hazard Codes | Xn,N | | Risk Statements | 22-40-50/53-67-36/37/38 | | Safety Statements | 36/37-46-60-61-24/25-23 | | RIDADR | UN 1334 4.1/PG 3 | | WGK Germany | 3 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 28459000 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Flam. Sol. 2 |
| | NAPHTHALENE-D8 Usage And Synthesis |
| Chemical Properties | white crystals | | Uses | Naphthalene-d8 can be intended for use as an internal standard for the quantification of Naphthalene by GC- or LC-mass spectrometry. | | Uses | May be used as an analytical standard |
| | NAPHTHALENE-D8 Preparation Products And Raw materials |
|