|
|
| | 1-(2-(((1-ETHYLOXY)ETHYL)OXY)ETHYL)BENZENE Basic information |
| Product Name: | 1-(2-(((1-ETHYLOXY)ETHYL)OXY)ETHYL)BENZENE | | Synonyms: | (2-(1-ethoxyethoxy)ethyl)-benzen;(2-(1-ethoxyethoxy)ethyl)benzene;[2-(1-ethoxyethoxy)ethyl]-benzen;[2-(1-ethoxyethoxy)ethyl]-Benzene;1-ethoxy-1-(2-phenylethoxy)-Ethane;ACETALDEHYDE:ETHYL PHENETHYL ACETAL;ACETALDEHYDE ETHYL PHENYL ETHYL ACETAL;1-ETHOXY-1-PHENYLETHOXYETHANE | | CAS: | 2556-10-7 | | MF: | C12H18O2 | | MW: | 194.27 | | EINECS: | 219-868-9 | | Product Categories: | | | Mol File: | 2556-10-7.mol |  |
| | 1-(2-(((1-ETHYLOXY)ETHYL)OXY)ETHYL)BENZENE Chemical Properties |
| Boiling point | 241.4±15.0℃ (760 Torr) | | density | 0.964±0.06 g/cm3 (20 ºC 760 Torr) | | vapor pressure | 3.1Pa at 24℃ | | refractive index | 1.5050 (estimate) | | Fp | 77.7±19.9℃ | | storage temp. | 2-8°C | | Odor | at 100.00 %. leafy green nasturtium fresh floral hyacinth | | Odor Type | green | | Water Solubility | 453mg/L at 24℃ | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C12H18O2/c1-3-13-11(2)14-10-9-12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3 | | InChIKey | QQDGMPOYFGNLMT-UHFFFAOYSA-N | | SMILES | C1(CCOC(OCC)C)=CC=CC=C1 | | LogP | 3.5 at 25℃ | | EPA Substance Registry System | [2-(1-Ethoxyethoxy)ethyl]benzene (2556-10-7) |
| | 1-(2-(((1-ETHYLOXY)ETHYL)OXY)ETHYL)BENZENE Usage And Synthesis |
| Chemical Properties | 1-(2-(((1-ETHYLOXY)ETHYL)OXY)ETHYL)BENZENE is a colorless liquid, d20
4 0.954–0.962, n20
D 1.478–1.483,
with powerful leafy-green, nasturtium, and hyacinth note. It can be synthesized
by reaction of a 1 : 1M ratio of ethyl vinyl ether and phenylethyl alcohol in the
presence of cation exchange resin [313]. It imparts fresh, floral, green notes and is
used in fine fragrances as well as in soap, cosmetics, and detergents. | | Uses | Ethyl phenethyl acetal is isolated from green nasturtium. | | Flammability and Explosibility | Non flammable | | Trade name | Hyacinth Body (IFF), VerotylTM (PFW) |
| | 1-(2-(((1-ETHYLOXY)ETHYL)OXY)ETHYL)BENZENE Preparation Products And Raw materials |
|